What is the 3-METHYL-2-NITROBENZYL ALCOHOL?

3-METHYL-2-NITROBENZYL ALCOHOL is yellow-brown to brownish crystalline solid, while it's Molecular Formula is C8H9NO3. yellow-brown to brownish crystalline solid 3-Methyl-2-nitrobenzyl alcohol was used as starting reagent in the synthesis of 7-formyl-indole.

What is the CAS number for 3-METHYL-2-NITROBENZYL ALCOHOL?

The CAS number of 3-METHYL-2-NITROBENZYL ALCOHOL is 80866-76-8.

What is 3-METHYL-2-NITROBENZYL ALCOHOL (80866-76-8) used for?

3-METHYL-2-NITROBENZYL ALCOHOL is an organic compound that serves as a key intermediate in the synthesis of various organic compounds, particularly in the production of pharmaceuticals and agrochemicals. It is characterized by its unique molecular structure, which features a nitro group at the 2-position and a methyl group at the 3-position on a benzyl alcohol backbone.InChI:InChI=1/C8H9NO3/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4,10H,5H2,1H3